About 4-methoxy-2-methyl-N-(3-pyridin-2-yl-1,2-oxazol-5-yl)benzamide
4-methoxy-2-methyl-N-(3-pyridin-2-yl-1,2-oxazol-5-yl)benzamide (PubChem CID 53143145) has the molecular formula C17H15N3O3
and a molecular weight of 309.33 g/mol. Its IUPAC name is 4-methoxy-2-methyl-N-(3-pyridin-2-yl-1,2-oxazol-5-yl)benzamide.
Molecular Properties
| Compound Name | 4-methoxy-2-methyl-N-(3-pyridin-2-yl-1,2-oxazol-5-yl)benzamide |
| PubChem CID | 53143145 |
| Molecular Formula | C17H15N3O3 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 4-methoxy-2-methyl-N-(3-pyridin-2-yl-1,2-oxazol-5-yl)benzamide |
| SMILES | COc1ccc(C(=O)Nc2cc(-c3ccccn3)no2)c(C)c1 |
| InChI | InChI=1S/C17H15N3O3/c1-11-9-12(22-2)6-7-13(11)17(21)19-16-10-15(20-23-16)14-5-3-4-8-18-14/h3-10H,1-2H3,(H,19,21) |
| InChIKey | FSFSZHUYMKFYHO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-methoxy-2-methyl-N-(3-pyridin-2-yl-1,2-oxazol-5-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-2-methyl-N-(3-pyridin-2-yl-1,2-oxazol-5-yl)benzamide?
The IUPAC name of 4-methoxy-2-methyl-N-(3-pyridin-2-yl-1,2-oxazol-5-yl)benzamide (CID 53143145) is 4-methoxy-2-methyl-N-(3-pyridin-2-yl-1,2-oxazol-5-yl)benzamide.
What is the SMILES notation for 4-methoxy-2-methyl-N-(3-pyridin-2-yl-1,2-oxazol-5-yl)benzamide?
The canonical SMILES for 4-methoxy-2-methyl-N-(3-pyridin-2-yl-1,2-oxazol-5-yl)benzamide is COc1ccc(C(=O)Nc2cc(-c3ccccn3)no2)c(C)c1.
What is the InChIKey of 4-methoxy-2-methyl-N-(3-pyridin-2-yl-1,2-oxazol-5-yl)benzamide?
The InChIKey is FSFSZHUYMKFYHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N3O3/c1-11-9-12(22-2)6-7-13(11)17(21)19-16-10-15(20-23-16)14-5-3-4-8-18-14/h3-10H,1-2H3,(H,19,21).
What are the key properties of 4-methoxy-2-methyl-N-(3-pyridin-2-yl-1,2-oxazol-5-yl)benzamide?
4-methoxy-2-methyl-N-(3-pyridin-2-yl-1,2-oxazol-5-yl)benzamide has a molecular weight of 309.33 g/mol, XLogP of 3.31, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-2-methyl-N-(3-pyridin-2-yl-1,2-oxazol-5-yl)benzamide is sourced from PubChem (CID 53143145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).