About 2,4-dimethoxy-N-(3-thiophen-2-yl-1,2-oxazol-5-yl)benzamide
2,4-dimethoxy-N-(3-thiophen-2-yl-1,2-oxazol-5-yl)benzamide (PubChem CID 53143162) has the molecular formula C16H14N2O4S
and a molecular weight of 330.37 g/mol. Its IUPAC name is 2,4-dimethoxy-N-(3-thiophen-2-yl-1,2-oxazol-5-yl)benzamide.
Molecular Properties
| Compound Name | 2,4-dimethoxy-N-(3-thiophen-2-yl-1,2-oxazol-5-yl)benzamide |
| PubChem CID | 53143162 |
| Molecular Formula | C16H14N2O4S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 2,4-dimethoxy-N-(3-thiophen-2-yl-1,2-oxazol-5-yl)benzamide |
| SMILES | COc1ccc(C(=O)Nc2cc(-c3cccs3)no2)c(OC)c1 |
| InChI | InChI=1S/C16H14N2O4S/c1-20-10-5-6-11(13(8-10)21-2)16(19)17-15-9-12(18-22-15)14-4-3-7-23-14/h3-9H,1-2H3,(H,17,19) |
| InChIKey | RHPKPLZYMVQHPK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2,4-dimethoxy-N-(3-thiophen-2-yl-1,2-oxazol-5-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethoxy-N-(3-thiophen-2-yl-1,2-oxazol-5-yl)benzamide?
The IUPAC name of 2,4-dimethoxy-N-(3-thiophen-2-yl-1,2-oxazol-5-yl)benzamide (CID 53143162) is 2,4-dimethoxy-N-(3-thiophen-2-yl-1,2-oxazol-5-yl)benzamide.
What is the SMILES notation for 2,4-dimethoxy-N-(3-thiophen-2-yl-1,2-oxazol-5-yl)benzamide?
The canonical SMILES for 2,4-dimethoxy-N-(3-thiophen-2-yl-1,2-oxazol-5-yl)benzamide is COc1ccc(C(=O)Nc2cc(-c3cccs3)no2)c(OC)c1.
What is the InChIKey of 2,4-dimethoxy-N-(3-thiophen-2-yl-1,2-oxazol-5-yl)benzamide?
The InChIKey is RHPKPLZYMVQHPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O4S/c1-20-10-5-6-11(13(8-10)21-2)16(19)17-15-9-12(18-22-15)14-4-3-7-23-14/h3-9H,1-2H3,(H,17,19).
What are the key properties of 2,4-dimethoxy-N-(3-thiophen-2-yl-1,2-oxazol-5-yl)benzamide?
2,4-dimethoxy-N-(3-thiophen-2-yl-1,2-oxazol-5-yl)benzamide has a molecular weight of 330.37 g/mol, XLogP of 3.67, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethoxy-N-(3-thiophen-2-yl-1,2-oxazol-5-yl)benzamide is sourced from PubChem (CID 53143162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).