About [(1S,2S)-2-methylcyclobutyl]benzene
[(1S,2S)-2-methylcyclobutyl]benzene (PubChem CID 5314354) has the molecular formula C11H14
and a molecular weight of 146.23 g/mol. Its IUPAC name is [(1S,2S)-2-methylcyclobutyl]benzene.
Molecular Properties
| Compound Name | [(1S,2S)-2-methylcyclobutyl]benzene |
| PubChem CID | 5314354 |
| Molecular Formula | C11H14 |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | [(1S,2S)-2-methylcyclobutyl]benzene |
| SMILES | C[C@H]1CC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C11H14/c1-9-7-8-11(9)10-5-3-2-4-6-10/h2-6,9,11H,7-8H2,1H3/t9-,11-/m0/s1 |
| InChIKey | ITGIKNADGPTMKM-ONGXEEELSA-N |
| XLogP | 3.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze [(1S,2S)-2-methylcyclobutyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2S)-2-methylcyclobutyl]benzene?
The IUPAC name of [(1S,2S)-2-methylcyclobutyl]benzene (CID 5314354) is [(1S,2S)-2-methylcyclobutyl]benzene.
What is the SMILES notation for [(1S,2S)-2-methylcyclobutyl]benzene?
The canonical SMILES for [(1S,2S)-2-methylcyclobutyl]benzene is C[C@H]1CC[C@@H]1c1ccccc1.
What is the InChIKey of [(1S,2S)-2-methylcyclobutyl]benzene?
The InChIKey is ITGIKNADGPTMKM-ONGXEEELSA-N. The full InChI is InChI=1S/C11H14/c1-9-7-8-11(9)10-5-3-2-4-6-10/h2-6,9,11H,7-8H2,1H3/t9-,11-/m0/s1.
What are the key properties of [(1S,2S)-2-methylcyclobutyl]benzene?
[(1S,2S)-2-methylcyclobutyl]benzene has a molecular weight of 146.23 g/mol, XLogP of 3.20, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2S)-2-methylcyclobutyl]benzene is sourced from PubChem (CID 5314354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).