About 2-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-oxoquinolin-1-yl]-N-phenylacetamide
2-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-oxoquinolin-1-yl]-N-phenylacetamide (PubChem CID 53143782) has the molecular formula C20H16N4O3
and a molecular weight of 360.37 g/mol. Its IUPAC name is 2-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-oxoquinolin-1-yl]-N-phenylacetamide.
Molecular Properties
| Compound Name | 2-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-oxoquinolin-1-yl]-N-phenylacetamide |
| PubChem CID | 53143782 |
| Molecular Formula | C20H16N4O3 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 2-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-oxoquinolin-1-yl]-N-phenylacetamide |
| SMILES | Cc1noc(-c2cc(=O)n(CC(=O)Nc3ccccc3)c3ccccc23)n1 |
| InChI | InChI=1S/C20H16N4O3/c1-13-21-20(27-23-13)16-11-19(26)24(17-10-6-5-9-15(16)17)12-18(25)22-14-7-3-2-4-8-14/h2-11H,12H2,1H3,(H,22,25) |
| InChIKey | KXPPKVKCOPKWJZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 90.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-oxoquinolin-1-yl]-N-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-oxoquinolin-1-yl]-N-phenylacetamide?
The IUPAC name of 2-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-oxoquinolin-1-yl]-N-phenylacetamide (CID 53143782) is 2-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-oxoquinolin-1-yl]-N-phenylacetamide.
What is the SMILES notation for 2-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-oxoquinolin-1-yl]-N-phenylacetamide?
The canonical SMILES for 2-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-oxoquinolin-1-yl]-N-phenylacetamide is Cc1noc(-c2cc(=O)n(CC(=O)Nc3ccccc3)c3ccccc23)n1.
What is the InChIKey of 2-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-oxoquinolin-1-yl]-N-phenylacetamide?
The InChIKey is KXPPKVKCOPKWJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N4O3/c1-13-21-20(27-23-13)16-11-19(26)24(17-10-6-5-9-15(16)17)12-18(25)22-14-7-3-2-4-8-14/h2-11H,12H2,1H3,(H,22,25).
What are the key properties of 2-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-oxoquinolin-1-yl]-N-phenylacetamide?
2-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-oxoquinolin-1-yl]-N-phenylacetamide has a molecular weight of 360.37 g/mol, XLogP of 3.00, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-oxoquinolin-1-yl]-N-phenylacetamide is sourced from PubChem (CID 53143782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).