C25H22N2O5 — CID 53144125
methyl 2-[[2-[3-hydroxy-3-(4-methylphenyl)-2-oxoindol-1-yl]acetyl]amino]benzoate (PubChem CID 53144125) has the molecular formula C25H22N2O5 and a molecular weight of 430.46 g/mol. Its IUPAC name is methyl 2-[[2-[3-hydroxy-3-(4-methylphenyl)-2-oxoindol-1-yl]acetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-[3-hydroxy-3-(4-methylphenyl)-2-oxoindol-1-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 53144125 |
| Molecular Formula | C25H22N2O5 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | methyl 2-[[2-[3-hydroxy-3-(4-methylphenyl)-2-oxoindol-1-yl]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)CN1C(=O)C(O)(c2ccc(C)cc2)c2ccccc21 |
| InChI | InChI=1S/C25H22N2O5/c1-16-11-13-17(14-12-16)25(31)19-8-4-6-10-21(19)27(24(25)30)15-22(28)26-20-9-5-3-7-18(20)23(29)32-2/h3-14,31H,15H2,1-2H3,(H,26,28) |
| InChIKey | NAJCPOCRPTWUQA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |