C17H24N4O — CID 53144575
1-cyclohexyl-3-[2-(1-methylpyrrolo[2,3-b]pyridin-3-yl)ethyl]urea (PubChem CID 53144575) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is 1-cyclohexyl-3-[2-(1-methylpyrrolo[2,3-b]pyridin-3-yl)ethyl]urea.
| Compound Name | 1-cyclohexyl-3-[2-(1-methylpyrrolo[2,3-b]pyridin-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 53144575 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 1-cyclohexyl-3-[2-(1-methylpyrrolo[2,3-b]pyridin-3-yl)ethyl]urea |
| SMILES | Cn1cc(CCNC(=O)NC2CCCCC2)c2cccnc21 |
| InChI | InChI=1S/C17H24N4O/c1-21-12-13(15-8-5-10-18-16(15)21)9-11-19-17(22)20-14-6-3-2-4-7-14/h5,8,10,12,14H,2-4,6-7,9,11H2,1H3,(H2,19,20,22) |
| InChIKey | DERZYSKTXLAEMX-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |