C18H17F2N3O — CID 53144971
N-[2-(1-ethylpyrrolo[2,3-b]pyridin-3-yl)ethyl]-2,5-difluorobenzamide (PubChem CID 53144971) has the molecular formula C18H17F2N3O and a molecular weight of 329.35 g/mol. Its IUPAC name is N-[2-(1-ethylpyrrolo[2,3-b]pyridin-3-yl)ethyl]-2,5-difluorobenzamide.
| Compound Name | N-[2-(1-ethylpyrrolo[2,3-b]pyridin-3-yl)ethyl]-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 53144971 |
| Molecular Formula | C18H17F2N3O |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | N-[2-(1-ethylpyrrolo[2,3-b]pyridin-3-yl)ethyl]-2,5-difluorobenzamide |
| SMILES | CCn1cc(CCNC(=O)c2cc(F)ccc2F)c2cccnc21 |
| InChI | InChI=1S/C18H17F2N3O/c1-2-23-11-12(14-4-3-8-21-17(14)23)7-9-22-18(24)15-10-13(19)5-6-16(15)20/h3-6,8,10-11H,2,7,9H2,1H3,(H,22,24) |
| InChIKey | ZWNJALNTFFEGRI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |