C19H21ClN4O — CID 53145168
6-chloro-N-[2-[1-(2-methylpropyl)pyrrolo[2,3-b]pyridin-3-yl]ethyl]pyridine-3-carboxamide (PubChem CID 53145168) has the molecular formula C19H21ClN4O and a molecular weight of 356.86 g/mol. Its IUPAC name is 6-chloro-N-[2-[1-(2-methylpropyl)pyrrolo[2,3-b]pyridin-3-yl]ethyl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[2-[1-(2-methylpropyl)pyrrolo[2,3-b]pyridin-3-yl]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 53145168 |
| Molecular Formula | C19H21ClN4O |
| Molecular Weight | 356.86 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 6-chloro-N-[2-[1-(2-methylpropyl)pyrrolo[2,3-b]pyridin-3-yl]ethyl]pyridine-3-carboxamide |
| SMILES | CC(C)Cn1cc(CCNC(=O)c2ccc(Cl)nc2)c2cccnc21 |
| InChI | InChI=1S/C19H21ClN4O/c1-13(2)11-24-12-15(16-4-3-8-21-18(16)24)7-9-22-19(25)14-5-6-17(20)23-10-14/h3-6,8,10,12-13H,7,9,11H2,1-2H3,(H,22,25) |
| InChIKey | QKYPWZWBZNJNDU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.86 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|