C10H17N3O2S — CID 53145325
5-butylsulfonyl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine (PubChem CID 53145325) has the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. Its IUPAC name is 5-butylsulfonyl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine.
| Compound Name | 5-butylsulfonyl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 53145325 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 5-butylsulfonyl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine |
| SMILES | CCCCS(=O)(=O)N1CCc2nc[nH]c2C1 |
| InChI | InChI=1S/C10H17N3O2S/c1-2-3-6-16(14,15)13-5-4-9-10(7-13)12-8-11-9/h8H,2-7H2,1H3,(H,11,12) |
| InChIKey | QHAAOZQNKDELDH-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |