About 1-bromo-2,3,5-trimethoxybenzene
1-bromo-2,3,5-trimethoxybenzene (PubChem CID 5314601) has the molecular formula C9H11BrO3
and a molecular weight of 247.09 g/mol. Its IUPAC name is 1-bromo-2,3,5-trimethoxybenzene.
Molecular Properties
| Compound Name | 1-bromo-2,3,5-trimethoxybenzene |
| PubChem CID | 5314601 |
| Molecular Formula | C9H11BrO3 |
| Molecular Weight | 247.09 g/mol |
| Exact Mass | 245.99 |
| IUPAC Name | 1-bromo-2,3,5-trimethoxybenzene |
| SMILES | COc1cc(Br)c(OC)c(OC)c1 |
| InChI | InChI=1S/C9H11BrO3/c1-11-6-4-7(10)9(13-3)8(5-6)12-2/h4-5H,1-3H3 |
| InChIKey | GMORDWZSIZHNNW-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.09 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-bromo-2,3,5-trimethoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2,3,5-trimethoxybenzene?
The IUPAC name of 1-bromo-2,3,5-trimethoxybenzene (CID 5314601) is 1-bromo-2,3,5-trimethoxybenzene.
What is the SMILES notation for 1-bromo-2,3,5-trimethoxybenzene?
The canonical SMILES for 1-bromo-2,3,5-trimethoxybenzene is COc1cc(Br)c(OC)c(OC)c1.
What is the InChIKey of 1-bromo-2,3,5-trimethoxybenzene?
The InChIKey is GMORDWZSIZHNNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11BrO3/c1-11-6-4-7(10)9(13-3)8(5-6)12-2/h4-5H,1-3H3.
What are the key properties of 1-bromo-2,3,5-trimethoxybenzene?
1-bromo-2,3,5-trimethoxybenzene has a molecular weight of 247.09 g/mol, XLogP of 2.47, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2,3,5-trimethoxybenzene is sourced from PubChem (CID 5314601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).