C20H17FN2O — CID 53148188
2-fluoro-N-[[2-(3-methylphenyl)-3-pyridinyl]methyl]benzamide (PubChem CID 53148188) has the molecular formula C20H17FN2O and a molecular weight of 320.37 g/mol. Its IUPAC name is 2-fluoro-N-[[2-(3-methylphenyl)-3-pyridinyl]methyl]benzamide.
| Compound Name | 2-fluoro-N-[[2-(3-methylphenyl)-3-pyridinyl]methyl]benzamide |
|---|---|
| PubChem CID | 53148188 |
| Molecular Formula | C20H17FN2O |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 2-fluoro-N-[[2-(3-methylphenyl)-3-pyridinyl]methyl]benzamide |
| SMILES | Cc1cccc(-c2ncccc2CNC(=O)c2ccccc2F)c1 |
| InChI | InChI=1S/C20H17FN2O/c1-14-6-4-7-15(12-14)19-16(8-5-11-22-19)13-23-20(24)17-9-2-3-10-18(17)21/h2-12H,13H2,1H3,(H,23,24) |
| InChIKey | FKGHRLJONWRVLD-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |