C25H25N5O — CID 53148865
[3-(3-methylimidazo[4,5-b]pyridin-2-yl)phenyl]-[4-(4-methylphenyl)piperazin-1-yl]methanone (PubChem CID 53148865) has the molecular formula C25H25N5O and a molecular weight of 411.51 g/mol. Its IUPAC name is [3-(3-methylimidazo[4,5-b]pyridin-2-yl)phenyl]-[4-(4-methylphenyl)piperazin-1-yl]methanone.
| Compound Name | [3-(3-methylimidazo[4,5-b]pyridin-2-yl)phenyl]-[4-(4-methylphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 53148865 |
| Molecular Formula | C25H25N5O |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | [3-(3-methylimidazo[4,5-b]pyridin-2-yl)phenyl]-[4-(4-methylphenyl)piperazin-1-yl]methanone |
| SMILES | Cc1ccc(N2CCN(C(=O)c3cccc(-c4nc5cccnc5n4C)c3)CC2)cc1 |
| InChI | InChI=1S/C25H25N5O/c1-18-8-10-21(11-9-18)29-13-15-30(16-14-29)25(31)20-6-3-5-19(17-20)23-27-22-7-4-12-26-24(22)28(23)2/h3-12,17H,13-16H2,1-2H3 |
| InChIKey | QIPKAPGURLWMLM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|