C20H24FNO2S — CID 53150621
1-[4-[2-[(3-fluorophenyl)methoxy]ethyl]piperidin-1-yl]-2-thiophen-2-ylethanone (PubChem CID 53150621) has the molecular formula C20H24FNO2S and a molecular weight of 361.48 g/mol. Its IUPAC name is 1-[4-[2-[(3-fluorophenyl)methoxy]ethyl]piperidin-1-yl]-2-thiophen-2-ylethanone.
| Compound Name | 1-[4-[2-[(3-fluorophenyl)methoxy]ethyl]piperidin-1-yl]-2-thiophen-2-ylethanone |
|---|---|
| PubChem CID | 53150621 |
| Molecular Formula | C20H24FNO2S |
| Molecular Weight | 361.48 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 1-[4-[2-[(3-fluorophenyl)methoxy]ethyl]piperidin-1-yl]-2-thiophen-2-ylethanone |
| SMILES | O=C(Cc1cccs1)N1CCC(CCOCc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C20H24FNO2S/c21-18-4-1-3-17(13-18)15-24-11-8-16-6-9-22(10-7-16)20(23)14-19-5-2-12-25-19/h1-5,12-13,16H,6-11,14-15H2 |
| InChIKey | OMPQCMXOHQRWCM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|