C14H14N4O3S — CID 53151436
2-[4,4-dioxo-3-(pyrrolidine-1-carbonyl)-4λ6,1,2-benzothiadiazin-1-yl]acetonitrile (PubChem CID 53151436) has the molecular formula C14H14N4O3S and a molecular weight of 318.36 g/mol. Its IUPAC name is 2-[4,4-dioxo-3-(pyrrolidine-1-carbonyl)-4λ6,1,2-benzothiadiazin-1-yl]acetonitrile.
| Compound Name | 2-[4,4-dioxo-3-(pyrrolidine-1-carbonyl)-4λ6,1,2-benzothiadiazin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 53151436 |
| Molecular Formula | C14H14N4O3S |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 2-[4,4-dioxo-3-(pyrrolidine-1-carbonyl)-4λ6,1,2-benzothiadiazin-1-yl]acetonitrile |
| SMILES | N#CCN1N=C(C(=O)N2CCCC2)S(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C14H14N4O3S/c15-7-10-18-11-5-1-2-6-12(11)22(20,21)13(16-18)14(19)17-8-3-4-9-17/h1-2,5-6H,3-4,8-10H2 |
| InChIKey | SCBWBNCVNOWBIU-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 93.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|