About 7-methyl-6,7-dihydro-5H-cyclopenta[c]pyridin-6-ol
7-methyl-6,7-dihydro-5H-cyclopenta[c]pyridin-6-ol (PubChem CID 5315179) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is 7-methyl-6,7-dihydro-5H-cyclopenta[c]pyridin-6-ol.
Molecular Properties
| Compound Name | 7-methyl-6,7-dihydro-5H-cyclopenta[c]pyridin-6-ol |
| PubChem CID | 5315179 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 7-methyl-6,7-dihydro-5H-cyclopenta[c]pyridin-6-ol |
| SMILES | CC1c2cnccc2CC1O |
| InChI | InChI=1S/C9H11NO/c1-6-8-5-10-3-2-7(8)4-9(6)11/h2-3,5-6,9,11H,4H2,1H3 |
| InChIKey | IOIGOIPHPUCFOB-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-methyl-6,7-dihydro-5H-cyclopenta[c]pyridin-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-6,7-dihydro-5H-cyclopenta[c]pyridin-6-ol?
The IUPAC name of 7-methyl-6,7-dihydro-5H-cyclopenta[c]pyridin-6-ol (CID 5315179) is 7-methyl-6,7-dihydro-5H-cyclopenta[c]pyridin-6-ol.
What is the SMILES notation for 7-methyl-6,7-dihydro-5H-cyclopenta[c]pyridin-6-ol?
The canonical SMILES for 7-methyl-6,7-dihydro-5H-cyclopenta[c]pyridin-6-ol is CC1c2cnccc2CC1O.
What is the InChIKey of 7-methyl-6,7-dihydro-5H-cyclopenta[c]pyridin-6-ol?
The InChIKey is IOIGOIPHPUCFOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO/c1-6-8-5-10-3-2-7(8)4-9(6)11/h2-3,5-6,9,11H,4H2,1H3.
What are the key properties of 7-methyl-6,7-dihydro-5H-cyclopenta[c]pyridin-6-ol?
7-methyl-6,7-dihydro-5H-cyclopenta[c]pyridin-6-ol has a molecular weight of 149.19 g/mol, XLogP of 1.10, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-6,7-dihydro-5H-cyclopenta[c]pyridin-6-ol is sourced from PubChem (CID 5315179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).