C17H14N2O3 — CID 53152644
3-(9-methoxy-3-oxo-5H-1,4-benzoxazepin-4-yl)benzonitrile (PubChem CID 53152644) has the molecular formula C17H14N2O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is 3-(9-methoxy-3-oxo-5H-1,4-benzoxazepin-4-yl)benzonitrile.
| Compound Name | 3-(9-methoxy-3-oxo-5H-1,4-benzoxazepin-4-yl)benzonitrile |
|---|---|
| PubChem CID | 53152644 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 3-(9-methoxy-3-oxo-5H-1,4-benzoxazepin-4-yl)benzonitrile |
| SMILES | COc1cccc2c1OCC(=O)N(c1cccc(C#N)c1)C2 |
| InChI | InChI=1S/C17H14N2O3/c1-21-15-7-3-5-13-10-19(16(20)11-22-17(13)15)14-6-2-4-12(8-14)9-18/h2-8H,10-11H2,1H3 |
| InChIKey | KPDVTZZHPWNGOL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |