C39H49NO18 — CID 5315312
(20,21,23,24,26-pentaacetyloxy-27-hydroxy-3,16,27-trimethyl-6,17-dioxo-2,5,18-trioxa-11-azapentacyclo[17.7.1.01,22.03,25.07,12]heptacosa-7(12),8,10-trien-22-yl)methyl acetate (PubChem CID 5315312) has the molecular formula C39H49NO18 and a molecular weight of 819.81 g/mol. Its IUPAC name is (20,21,23,24,26-pentaacetyloxy-27-hydroxy-3,16,27-trimethyl-6,17-dioxo-2,5,18-trioxa-11-azapentacyclo[17.7.1.01,22.03,25.07,12]heptacosa-7(12),8,10-trien-22-yl)methyl acetate.
| Compound Name | (20,21,23,24,26-pentaacetyloxy-27-hydroxy-3,16,27-trimethyl-6,17-dioxo-2,5,18-trioxa-11-azapentacyclo[17.7.1.01,22.03,25.07,12]heptacosa-7(12),8,10-trien-22-yl)methyl acetate |
|---|---|
| PubChem CID | 5315312 |
| Molecular Formula | C39H49NO18 |
| Molecular Weight | 819.81 g/mol |
| Exact Mass | 819.29 |
| IUPAC Name | (20,21,23,24,26-pentaacetyloxy-27-hydroxy-3,16,27-trimethyl-6,17-dioxo-2,5,18-trioxa-11-azapentacyclo[17.7.1.01,22.03,25.07,12]heptacosa-7(12),8,10-trien-22-yl)methyl acetate |
| SMILES | CC(=O)OCC12C(OC(C)=O)C(OC(C)=O)C3C(OC(C)=O)C14OC3(C)COC(=O)c1cccnc1CCCC(C)C(=O)OC(C(OC(C)=O)C2OC(C)=O)C4(C)O |
| InChI | InChI=1S/C39H49NO18/c1-18-12-10-14-26-25(13-11-15-40-26)35(48)51-16-36(8)27-28(52-20(3)42)32(55-23(6)45)38(17-50-19(2)41)33(56-24(7)46)29(53-21(4)43)31(57-34(18)47)37(9,49)39(38,58-36)30(27)54-22(5)44/h11,13,15,18,27-33,49H,10,12,14,16-17H2,1-9H3 |
| InChIKey | PXMGNBZJAJJMAE-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 252.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.81 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|