methyl 2-(2,2-dimethylpropanoylamino)-3-methylbutanoate

C11H21NO3 — CID 531533

IUPACmethyl 2-(2,2-dimethylpropanoylamino)-3-methylbutanoate
SMILESCOC(=O)C(NC(=O)C(C)(C)C)C(C)C
InChIInChI=1S/C11H21NO3/c1-7(2)8(9(13)15-6)12-10(14)11(3,4)5/h7-8H,1-6H3,(H,12,14)
InChIKeyZOMUUMHLEGAWIX-UHFFFAOYSA-N
MW215.29 g/mol
LogP1.35
Rot. Bonds3

About methyl 2-(2,2-dimethylpropanoylamino)-3-methylbutanoate

methyl 2-(2,2-dimethylpropanoylamino)-3-methylbutanoate (PubChem CID 531533) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is methyl 2-(2,2-dimethylpropanoylamino)-3-methylbutanoate.

Molecular Properties

Compound Namemethyl 2-(2,2-dimethylpropanoylamino)-3-methylbutanoate
PubChem CID531533
Molecular FormulaC11H21NO3
Molecular Weight215.29 g/mol
Exact Mass215.15
IUPAC Namemethyl 2-(2,2-dimethylpropanoylamino)-3-methylbutanoate
SMILESCOC(=O)C(NC(=O)C(C)(C)C)C(C)C
InChIInChI=1S/C11H21NO3/c1-7(2)8(9(13)15-6)12-10(14)11(3,4)5/h7-8H,1-6H3,(H,12,14)
InChIKeyZOMUUMHLEGAWIX-UHFFFAOYSA-N
XLogP1.35
TPSA55.40 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500215.29
LogP ≤ 51.35
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 2-(2,2-dimethylpropanoylamino)-3-methylbutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(2,2-dimethylpropanoylamino)-3-methylbutanoate?
The IUPAC name of methyl 2-(2,2-dimethylpropanoylamino)-3-methylbutanoate (CID 531533) is methyl 2-(2,2-dimethylpropanoylamino)-3-methylbutanoate.
What is the SMILES notation for methyl 2-(2,2-dimethylpropanoylamino)-3-methylbutanoate?
The canonical SMILES for methyl 2-(2,2-dimethylpropanoylamino)-3-methylbutanoate is COC(=O)C(NC(=O)C(C)(C)C)C(C)C.
What is the InChIKey of methyl 2-(2,2-dimethylpropanoylamino)-3-methylbutanoate?
The InChIKey is ZOMUUMHLEGAWIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO3/c1-7(2)8(9(13)15-6)12-10(14)11(3,4)5/h7-8H,1-6H3,(H,12,14).
What are the key properties of methyl 2-(2,2-dimethylpropanoylamino)-3-methylbutanoate?
methyl 2-(2,2-dimethylpropanoylamino)-3-methylbutanoate has a molecular weight of 215.29 g/mol, XLogP of 1.35, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2,2-dimethylpropanoylamino)-3-methylbutanoate is sourced from PubChem (CID 531533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).