C16H14ClN5O2S — CID 53153436
N-(4-chlorophenyl)-N-(cyanomethyl)-3-ethyl-[1,2,4]triazolo[4,3-a]pyridine-8-sulfonamide (PubChem CID 53153436) has the molecular formula C16H14ClN5O2S and a molecular weight of 375.84 g/mol. Its IUPAC name is N-(4-chlorophenyl)-N-(cyanomethyl)-3-ethyl-[1,2,4]triazolo[4,3-a]pyridine-8-sulfonamide.
| Compound Name | N-(4-chlorophenyl)-N-(cyanomethyl)-3-ethyl-[1,2,4]triazolo[4,3-a]pyridine-8-sulfonamide |
|---|---|
| PubChem CID | 53153436 |
| Molecular Formula | C16H14ClN5O2S |
| Molecular Weight | 375.84 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | N-(4-chlorophenyl)-N-(cyanomethyl)-3-ethyl-[1,2,4]triazolo[4,3-a]pyridine-8-sulfonamide |
| SMILES | CCc1nnc2c(S(=O)(=O)N(CC#N)c3ccc(Cl)cc3)cccn12 |
| InChI | InChI=1S/C16H14ClN5O2S/c1-2-15-19-20-16-14(4-3-10-21(15)16)25(23,24)22(11-9-18)13-7-5-12(17)6-8-13/h3-8,10H,2,11H2,1H3 |
| InChIKey | OPXGTJUNEYOCHG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 91.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.84 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|