C24H26N4O3 — CID 53156071
4-methoxy-N-[1-[3-(2-methylphenyl)-1H-pyrazole-5-carbonyl]piperidin-4-yl]benzamide (PubChem CID 53156071) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is 4-methoxy-N-[1-[3-(2-methylphenyl)-1H-pyrazole-5-carbonyl]piperidin-4-yl]benzamide.
| Compound Name | 4-methoxy-N-[1-[3-(2-methylphenyl)-1H-pyrazole-5-carbonyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 53156071 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 4-methoxy-N-[1-[3-(2-methylphenyl)-1H-pyrazole-5-carbonyl]piperidin-4-yl]benzamide |
| SMILES | COc1ccc(C(=O)NC2CCN(C(=O)c3cc(-c4ccccc4C)n[nH]3)CC2)cc1 |
| InChI | InChI=1S/C24H26N4O3/c1-16-5-3-4-6-20(16)21-15-22(27-26-21)24(30)28-13-11-18(12-14-28)25-23(29)17-7-9-19(31-2)10-8-17/h3-10,15,18H,11-14H2,1-2H3,(H,25,29)(H,26,27) |
| InChIKey | XHAGSULXVOCQSP-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |