About N-[[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)thiophen-2-yl]methyl]thiophene-3-carboxamide
N-[[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)thiophen-2-yl]methyl]thiophene-3-carboxamide (PubChem CID 53156199) has the molecular formula C15H13N3O2S2
and a molecular weight of 331.42 g/mol. Its IUPAC name is N-[[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)thiophen-2-yl]methyl]thiophene-3-carboxamide.
Molecular Properties
| Compound Name | N-[[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)thiophen-2-yl]methyl]thiophene-3-carboxamide |
| PubChem CID | 53156199 |
| Molecular Formula | C15H13N3O2S2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | N-[[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)thiophen-2-yl]methyl]thiophene-3-carboxamide |
| SMILES | O=C(NCc1ccc(-c2nc(C3CC3)no2)s1)c1ccsc1 |
| InChI | InChI=1S/C15H13N3O2S2/c19-14(10-5-6-21-8-10)16-7-11-3-4-12(22-11)15-17-13(18-20-15)9-1-2-9/h3-6,8-9H,1-2,7H2,(H,16,19) |
| InChIKey | LLZDFUQMVPPQNH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)thiophen-2-yl]methyl]thiophene-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)thiophen-2-yl]methyl]thiophene-3-carboxamide?
The IUPAC name of N-[[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)thiophen-2-yl]methyl]thiophene-3-carboxamide (CID 53156199) is N-[[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)thiophen-2-yl]methyl]thiophene-3-carboxamide.
What is the SMILES notation for N-[[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)thiophen-2-yl]methyl]thiophene-3-carboxamide?
The canonical SMILES for N-[[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)thiophen-2-yl]methyl]thiophene-3-carboxamide is O=C(NCc1ccc(-c2nc(C3CC3)no2)s1)c1ccsc1.
What is the InChIKey of N-[[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)thiophen-2-yl]methyl]thiophene-3-carboxamide?
The InChIKey is LLZDFUQMVPPQNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3O2S2/c19-14(10-5-6-21-8-10)16-7-11-3-4-12(22-11)15-17-13(18-20-15)9-1-2-9/h3-6,8-9H,1-2,7H2,(H,16,19).
What are the key properties of N-[[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)thiophen-2-yl]methyl]thiophene-3-carboxamide?
N-[[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)thiophen-2-yl]methyl]thiophene-3-carboxamide has a molecular weight of 331.42 g/mol, XLogP of 3.67, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)thiophen-2-yl]methyl]thiophene-3-carboxamide is sourced from PubChem (CID 53156199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).