About 5-acetyl-N-(3-chloro-4-methoxyphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-sulfonamide
5-acetyl-N-(3-chloro-4-methoxyphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-sulfonamide (PubChem CID 53156251) has the molecular formula C16H17ClN2O4S2
and a molecular weight of 400.91 g/mol. Its IUPAC name is 5-acetyl-N-(3-chloro-4-methoxyphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-sulfonamide.
Molecular Properties
| Compound Name | 5-acetyl-N-(3-chloro-4-methoxyphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-sulfonamide |
| PubChem CID | 53156251 |
| Molecular Formula | C16H17ClN2O4S2 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | 5-acetyl-N-(3-chloro-4-methoxyphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-sulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cc3c(s2)CCN(C(C)=O)C3)cc1Cl |
| InChI | InChI=1S/C16H17ClN2O4S2/c1-10(20)19-6-5-15-11(9-19)7-16(24-15)25(21,22)18-12-3-4-14(23-2)13(17)8-12/h3-4,7-8,18H,5-6,9H2,1-2H3 |
| InChIKey | FVJWVQVAQZEASY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-acetyl-N-(3-chloro-4-methoxyphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-acetyl-N-(3-chloro-4-methoxyphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-sulfonamide?
The IUPAC name of 5-acetyl-N-(3-chloro-4-methoxyphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-sulfonamide (CID 53156251) is 5-acetyl-N-(3-chloro-4-methoxyphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-sulfonamide.
What is the SMILES notation for 5-acetyl-N-(3-chloro-4-methoxyphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-sulfonamide?
The canonical SMILES for 5-acetyl-N-(3-chloro-4-methoxyphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-sulfonamide is COc1ccc(NS(=O)(=O)c2cc3c(s2)CCN(C(C)=O)C3)cc1Cl.
What is the InChIKey of 5-acetyl-N-(3-chloro-4-methoxyphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-sulfonamide?
The InChIKey is FVJWVQVAQZEASY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17ClN2O4S2/c1-10(20)19-6-5-15-11(9-19)7-16(24-15)25(21,22)18-12-3-4-14(23-2)13(17)8-12/h3-4,7-8,18H,5-6,9H2,1-2H3.
What are the key properties of 5-acetyl-N-(3-chloro-4-methoxyphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-sulfonamide?
5-acetyl-N-(3-chloro-4-methoxyphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-sulfonamide has a molecular weight of 400.91 g/mol, XLogP of 3.12, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-acetyl-N-(3-chloro-4-methoxyphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-sulfonamide is sourced from PubChem (CID 53156251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).