C27H40O7 — CID 5315749
[(3S,8S,12R,13S,14R,17S)-17-acetyl-3,8,14,17-tetrahydroxy-13-methyl-2,3,4,7,9,10,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthren-12-yl] (E)-3,4-dimethylpent-2-enoate (PubChem CID 5315749) has the molecular formula C27H40O7 and a molecular weight of 476.61 g/mol. Its IUPAC name is [(3S,8S,12R,13S,14R,17S)-17-acetyl-3,8,14,17-tetrahydroxy-13-methyl-2,3,4,7,9,10,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthren-12-yl] (E)-3,4-dimethylpent-2-enoate.
| Compound Name | [(3S,8S,12R,13S,14R,17S)-17-acetyl-3,8,14,17-tetrahydroxy-13-methyl-2,3,4,7,9,10,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthren-12-yl] (E)-3,4-dimethylpent-2-enoate |
|---|---|
| PubChem CID | 5315749 |
| Molecular Formula | C27H40O7 |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | [(3S,8S,12R,13S,14R,17S)-17-acetyl-3,8,14,17-tetrahydroxy-13-methyl-2,3,4,7,9,10,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthren-12-yl] (E)-3,4-dimethylpent-2-enoate |
| SMILES | CC(=O)[C@]1(O)CC[C@@]2(O)[C@]1(C)[C@H](OC(=O)/C=C(\C)C(C)C)CC1C3CC[C@H](O)CC3=CC[C@]12O |
| InChI | InChI=1S/C27H40O7/c1-15(2)16(3)12-23(30)34-22-14-21-20-7-6-19(29)13-18(20)8-9-26(21,32)27(33)11-10-25(31,17(4)28)24(22,27)5/h8,12,15,19-22,29,31-33H,6-7,9-11,13-14H2,1-5H3/b16-12+/t19-,20?,21?,22+,24+,25+,26-,27+/m0/s1 |
| InChIKey | HEZLCMUCJHAPTI-PPJTUFDDSA-N |
| XLogP | 2.59 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|