C14H10FN5O2S — CID 53158171
N-(cyanomethyl)-N-(3-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridine-6-sulfonamide (PubChem CID 53158171) has the molecular formula C14H10FN5O2S and a molecular weight of 331.33 g/mol. Its IUPAC name is N-(cyanomethyl)-N-(3-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridine-6-sulfonamide.
| Compound Name | N-(cyanomethyl)-N-(3-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridine-6-sulfonamide |
|---|---|
| PubChem CID | 53158171 |
| Molecular Formula | C14H10FN5O2S |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | N-(cyanomethyl)-N-(3-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridine-6-sulfonamide |
| SMILES | N#CCN(c1cccc(F)c1)S(=O)(=O)c1ccc2nncn2c1 |
| InChI | InChI=1S/C14H10FN5O2S/c15-11-2-1-3-12(8-11)20(7-6-16)23(21,22)13-4-5-14-18-17-10-19(14)9-13/h1-5,8-10H,7H2 |
| InChIKey | UBGGXZNVPQYIDC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 91.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|