C16H13F2N5O2S — CID 53158235
N-(cyanomethyl)-N-(3,5-difluorophenyl)-3-ethyl-[1,2,4]triazolo[4,3-a]pyridine-6-sulfonamide (PubChem CID 53158235) has the molecular formula C16H13F2N5O2S and a molecular weight of 377.38 g/mol. Its IUPAC name is N-(cyanomethyl)-N-(3,5-difluorophenyl)-3-ethyl-[1,2,4]triazolo[4,3-a]pyridine-6-sulfonamide.
| Compound Name | N-(cyanomethyl)-N-(3,5-difluorophenyl)-3-ethyl-[1,2,4]triazolo[4,3-a]pyridine-6-sulfonamide |
|---|---|
| PubChem CID | 53158235 |
| Molecular Formula | C16H13F2N5O2S |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | N-(cyanomethyl)-N-(3,5-difluorophenyl)-3-ethyl-[1,2,4]triazolo[4,3-a]pyridine-6-sulfonamide |
| SMILES | CCc1nnc2ccc(S(=O)(=O)N(CC#N)c3cc(F)cc(F)c3)cn12 |
| InChI | InChI=1S/C16H13F2N5O2S/c1-2-15-20-21-16-4-3-14(10-22(15)16)26(24,25)23(6-5-19)13-8-11(17)7-12(18)9-13/h3-4,7-10H,2,6H2,1H3 |
| InChIKey | DCHYCBKUZRIOFU-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 91.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|