C11H11N3O3S — CID 53158295
4-N-[(5-methylfuran-2-yl)methyl]-1,3-thiazole-2,4-dicarboxamide (PubChem CID 53158295) has the molecular formula C11H11N3O3S and a molecular weight of 265.29 g/mol. Its IUPAC name is 4-N-[(5-methylfuran-2-yl)methyl]-1,3-thiazole-2,4-dicarboxamide.
| Compound Name | 4-N-[(5-methylfuran-2-yl)methyl]-1,3-thiazole-2,4-dicarboxamide |
|---|---|
| PubChem CID | 53158295 |
| Molecular Formula | C11H11N3O3S |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 4-N-[(5-methylfuran-2-yl)methyl]-1,3-thiazole-2,4-dicarboxamide |
| SMILES | Cc1ccc(CNC(=O)c2csc(C(N)=O)n2)o1 |
| InChI | InChI=1S/C11H11N3O3S/c1-6-2-3-7(17-6)4-13-10(16)8-5-18-11(14-8)9(12)15/h2-3,5H,4H2,1H3,(H2,12,15)(H,13,16) |
| InChIKey | CXGJLOUEGFMVAD-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |