About 1-chloro-4-(5-penta-1,3-diynylthiophen-2-yl)but-3-yn-2-ol
1-chloro-4-(5-penta-1,3-diynylthiophen-2-yl)but-3-yn-2-ol (PubChem CID 5315834) has the molecular formula C13H9ClOS
and a molecular weight of 248.73 g/mol. Its IUPAC name is 1-chloro-4-(5-penta-1,3-diynylthiophen-2-yl)but-3-yn-2-ol.
Molecular Properties
| Compound Name | 1-chloro-4-(5-penta-1,3-diynylthiophen-2-yl)but-3-yn-2-ol |
| PubChem CID | 5315834 |
| Molecular Formula | C13H9ClOS |
| Molecular Weight | 248.73 g/mol |
| Exact Mass | 248.01 |
| IUPAC Name | 1-chloro-4-(5-penta-1,3-diynylthiophen-2-yl)but-3-yn-2-ol |
| SMILES | CC#CC#Cc1ccc(C#CC(O)CCl)s1 |
| InChI | InChI=1S/C13H9ClOS/c1-2-3-4-5-12-8-9-13(16-12)7-6-11(15)10-14/h8-9,11,15H,10H2,1H3 |
| InChIKey | YSYBCKHAFOAQDX-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.73 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-4-(5-penta-1,3-diynylthiophen-2-yl)but-3-yn-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-(5-penta-1,3-diynylthiophen-2-yl)but-3-yn-2-ol?
The IUPAC name of 1-chloro-4-(5-penta-1,3-diynylthiophen-2-yl)but-3-yn-2-ol (CID 5315834) is 1-chloro-4-(5-penta-1,3-diynylthiophen-2-yl)but-3-yn-2-ol.
What is the SMILES notation for 1-chloro-4-(5-penta-1,3-diynylthiophen-2-yl)but-3-yn-2-ol?
The canonical SMILES for 1-chloro-4-(5-penta-1,3-diynylthiophen-2-yl)but-3-yn-2-ol is CC#CC#Cc1ccc(C#CC(O)CCl)s1.
What is the InChIKey of 1-chloro-4-(5-penta-1,3-diynylthiophen-2-yl)but-3-yn-2-ol?
The InChIKey is YSYBCKHAFOAQDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9ClOS/c1-2-3-4-5-12-8-9-13(16-12)7-6-11(15)10-14/h8-9,11,15H,10H2,1H3.
What are the key properties of 1-chloro-4-(5-penta-1,3-diynylthiophen-2-yl)but-3-yn-2-ol?
1-chloro-4-(5-penta-1,3-diynylthiophen-2-yl)but-3-yn-2-ol has a molecular weight of 248.73 g/mol, XLogP of 2.07, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-(5-penta-1,3-diynylthiophen-2-yl)but-3-yn-2-ol is sourced from PubChem (CID 5315834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).