About 5-acetyl-N-(3-methoxypropyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-carboxamide
5-acetyl-N-(3-methoxypropyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-carboxamide (PubChem CID 53158805) has the molecular formula C14H20N2O3S
and a molecular weight of 296.39 g/mol. Its IUPAC name is 5-acetyl-N-(3-methoxypropyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-carboxamide.
Molecular Properties
| Compound Name | 5-acetyl-N-(3-methoxypropyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-carboxamide |
| PubChem CID | 53158805 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 5-acetyl-N-(3-methoxypropyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-carboxamide |
| SMILES | COCCCNC(=O)c1cc2c(s1)CCN(C(C)=O)C2 |
| InChI | InChI=1S/C14H20N2O3S/c1-10(17)16-6-4-12-11(9-16)8-13(20-12)14(18)15-5-3-7-19-2/h8H,3-7,9H2,1-2H3,(H,15,18) |
| InChIKey | JMNRLULUYPZGOL-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-acetyl-N-(3-methoxypropyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-acetyl-N-(3-methoxypropyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-carboxamide?
The IUPAC name of 5-acetyl-N-(3-methoxypropyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-carboxamide (CID 53158805) is 5-acetyl-N-(3-methoxypropyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-carboxamide.
What is the SMILES notation for 5-acetyl-N-(3-methoxypropyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-carboxamide?
The canonical SMILES for 5-acetyl-N-(3-methoxypropyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-carboxamide is COCCCNC(=O)c1cc2c(s1)CCN(C(C)=O)C2.
What is the InChIKey of 5-acetyl-N-(3-methoxypropyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-carboxamide?
The InChIKey is JMNRLULUYPZGOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O3S/c1-10(17)16-6-4-12-11(9-16)8-13(20-12)14(18)15-5-3-7-19-2/h8H,3-7,9H2,1-2H3,(H,15,18).
What are the key properties of 5-acetyl-N-(3-methoxypropyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-carboxamide?
5-acetyl-N-(3-methoxypropyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-carboxamide has a molecular weight of 296.39 g/mol, XLogP of 1.42, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-acetyl-N-(3-methoxypropyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-carboxamide is sourced from PubChem (CID 53158805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).