C23H32N4O2 — CID 53160674
5-benzyl-1-methyl-N-(3-morpholin-4-ylpropyl)-6,7-dihydro-4H-pyrrolo[3,2-c]pyridine-2-carboxamide (PubChem CID 53160674) has the molecular formula C23H32N4O2 and a molecular weight of 396.54 g/mol. Its IUPAC name is 5-benzyl-1-methyl-N-(3-morpholin-4-ylpropyl)-6,7-dihydro-4H-pyrrolo[3,2-c]pyridine-2-carboxamide.
| Compound Name | 5-benzyl-1-methyl-N-(3-morpholin-4-ylpropyl)-6,7-dihydro-4H-pyrrolo[3,2-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 53160674 |
| Molecular Formula | C23H32N4O2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | 5-benzyl-1-methyl-N-(3-morpholin-4-ylpropyl)-6,7-dihydro-4H-pyrrolo[3,2-c]pyridine-2-carboxamide |
| SMILES | Cn1c(C(=O)NCCCN2CCOCC2)cc2c1CCN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C23H32N4O2/c1-25-21-8-11-27(17-19-6-3-2-4-7-19)18-20(21)16-22(25)23(28)24-9-5-10-26-12-14-29-15-13-26/h2-4,6-7,16H,5,8-15,17-18H2,1H3,(H,24,28) |
| InChIKey | XSVJIMVMKMAHKG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|