C24H34N4O — CID 53160698
5-benzyl-1-methyl-N-(3-piperidin-1-ylpropyl)-6,7-dihydro-4H-pyrrolo[3,2-c]pyridine-2-carboxamide (PubChem CID 53160698) has the molecular formula C24H34N4O and a molecular weight of 394.56 g/mol. Its IUPAC name is 5-benzyl-1-methyl-N-(3-piperidin-1-ylpropyl)-6,7-dihydro-4H-pyrrolo[3,2-c]pyridine-2-carboxamide.
| Compound Name | 5-benzyl-1-methyl-N-(3-piperidin-1-ylpropyl)-6,7-dihydro-4H-pyrrolo[3,2-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 53160698 |
| Molecular Formula | C24H34N4O |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | 5-benzyl-1-methyl-N-(3-piperidin-1-ylpropyl)-6,7-dihydro-4H-pyrrolo[3,2-c]pyridine-2-carboxamide |
| SMILES | Cn1c(C(=O)NCCCN2CCCCC2)cc2c1CCN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C24H34N4O/c1-26-22-11-16-28(18-20-9-4-2-5-10-20)19-21(22)17-23(26)24(29)25-12-8-15-27-13-6-3-7-14-27/h2,4-5,9-10,17H,3,6-8,11-16,18-19H2,1H3,(H,25,29) |
| InChIKey | WHFGUXKETJGYGI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|