About butyl 4-cyanobenzoate
butyl 4-cyanobenzoate (PubChem CID 531614) has the molecular formula C12H13NO2
and a molecular weight of 203.24 g/mol. Its IUPAC name is butyl 4-cyanobenzoate.
Molecular Properties
| Compound Name | butyl 4-cyanobenzoate |
| PubChem CID | 531614 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | butyl 4-cyanobenzoate |
| SMILES | CCCCOC(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C12H13NO2/c1-2-3-8-15-12(14)11-6-4-10(9-13)5-7-11/h4-7H,2-3,8H2,1H3 |
| InChIKey | SRGVIBGHRBGAAS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 4-cyanobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 4-cyanobenzoate?
The IUPAC name of butyl 4-cyanobenzoate (CID 531614) is butyl 4-cyanobenzoate.
What is the SMILES notation for butyl 4-cyanobenzoate?
The canonical SMILES for butyl 4-cyanobenzoate is CCCCOC(=O)c1ccc(C#N)cc1.
What is the InChIKey of butyl 4-cyanobenzoate?
The InChIKey is SRGVIBGHRBGAAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO2/c1-2-3-8-15-12(14)11-6-4-10(9-13)5-7-11/h4-7H,2-3,8H2,1H3.
What are the key properties of butyl 4-cyanobenzoate?
butyl 4-cyanobenzoate has a molecular weight of 203.24 g/mol, XLogP of 2.52, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 4-cyanobenzoate is sourced from PubChem (CID 531614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).