About 3-[3-(4-fluorophenyl)-1,2-oxazol-4-yl]-N-(oxolan-2-ylmethyl)propanamide
3-[3-(4-fluorophenyl)-1,2-oxazol-4-yl]-N-(oxolan-2-ylmethyl)propanamide (PubChem CID 53161757) has the molecular formula C17H19FN2O3
and a molecular weight of 318.35 g/mol. Its IUPAC name is 3-[3-(4-fluorophenyl)-1,2-oxazol-4-yl]-N-(oxolan-2-ylmethyl)propanamide.
Molecular Properties
| Compound Name | 3-[3-(4-fluorophenyl)-1,2-oxazol-4-yl]-N-(oxolan-2-ylmethyl)propanamide |
| PubChem CID | 53161757 |
| Molecular Formula | C17H19FN2O3 |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 3-[3-(4-fluorophenyl)-1,2-oxazol-4-yl]-N-(oxolan-2-ylmethyl)propanamide |
| SMILES | O=C(CCc1conc1-c1ccc(F)cc1)NCC1CCCO1 |
| InChI | InChI=1S/C17H19FN2O3/c18-14-6-3-12(4-7-14)17-13(11-23-20-17)5-8-16(21)19-10-15-2-1-9-22-15/h3-4,6-7,11,15H,1-2,5,8-10H2,(H,19,21) |
| InChIKey | QJKKGQYLCWWADU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[3-(4-fluorophenyl)-1,2-oxazol-4-yl]-N-(oxolan-2-ylmethyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(4-fluorophenyl)-1,2-oxazol-4-yl]-N-(oxolan-2-ylmethyl)propanamide?
The IUPAC name of 3-[3-(4-fluorophenyl)-1,2-oxazol-4-yl]-N-(oxolan-2-ylmethyl)propanamide (CID 53161757) is 3-[3-(4-fluorophenyl)-1,2-oxazol-4-yl]-N-(oxolan-2-ylmethyl)propanamide.
What is the SMILES notation for 3-[3-(4-fluorophenyl)-1,2-oxazol-4-yl]-N-(oxolan-2-ylmethyl)propanamide?
The canonical SMILES for 3-[3-(4-fluorophenyl)-1,2-oxazol-4-yl]-N-(oxolan-2-ylmethyl)propanamide is O=C(CCc1conc1-c1ccc(F)cc1)NCC1CCCO1.
What is the InChIKey of 3-[3-(4-fluorophenyl)-1,2-oxazol-4-yl]-N-(oxolan-2-ylmethyl)propanamide?
The InChIKey is QJKKGQYLCWWADU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19FN2O3/c18-14-6-3-12(4-7-14)17-13(11-23-20-17)5-8-16(21)19-10-15-2-1-9-22-15/h3-4,6-7,11,15H,1-2,5,8-10H2,(H,19,21).
What are the key properties of 3-[3-(4-fluorophenyl)-1,2-oxazol-4-yl]-N-(oxolan-2-ylmethyl)propanamide?
3-[3-(4-fluorophenyl)-1,2-oxazol-4-yl]-N-(oxolan-2-ylmethyl)propanamide has a molecular weight of 318.35 g/mol, XLogP of 2.71, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(4-fluorophenyl)-1,2-oxazol-4-yl]-N-(oxolan-2-ylmethyl)propanamide is sourced from PubChem (CID 53161757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).