About 2-(5-pyrazin-2-yl-1,3,4-oxadiazol-2-yl)-N-[4-(trifluoromethyl)phenyl]acetamide
2-(5-pyrazin-2-yl-1,3,4-oxadiazol-2-yl)-N-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 53162214) has the molecular formula C15H10F3N5O2
and a molecular weight of 349.27 g/mol. Its IUPAC name is 2-(5-pyrazin-2-yl-1,3,4-oxadiazol-2-yl)-N-[4-(trifluoromethyl)phenyl]acetamide.
Molecular Properties
| Compound Name | 2-(5-pyrazin-2-yl-1,3,4-oxadiazol-2-yl)-N-[4-(trifluoromethyl)phenyl]acetamide |
| PubChem CID | 53162214 |
| Molecular Formula | C15H10F3N5O2 |
| Molecular Weight | 349.27 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 2-(5-pyrazin-2-yl-1,3,4-oxadiazol-2-yl)-N-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(Cc1nnc(-c2cnccn2)o1)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H10F3N5O2/c16-15(17,18)9-1-3-10(4-2-9)21-12(24)7-13-22-23-14(25-13)11-8-19-5-6-20-11/h1-6,8H,7H2,(H,21,24) |
| InChIKey | YYBFZBRUJYRENJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 93.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.27 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(5-pyrazin-2-yl-1,3,4-oxadiazol-2-yl)-N-[4-(trifluoromethyl)phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-pyrazin-2-yl-1,3,4-oxadiazol-2-yl)-N-[4-(trifluoromethyl)phenyl]acetamide?
The IUPAC name of 2-(5-pyrazin-2-yl-1,3,4-oxadiazol-2-yl)-N-[4-(trifluoromethyl)phenyl]acetamide (CID 53162214) is 2-(5-pyrazin-2-yl-1,3,4-oxadiazol-2-yl)-N-[4-(trifluoromethyl)phenyl]acetamide.
What is the SMILES notation for 2-(5-pyrazin-2-yl-1,3,4-oxadiazol-2-yl)-N-[4-(trifluoromethyl)phenyl]acetamide?
The canonical SMILES for 2-(5-pyrazin-2-yl-1,3,4-oxadiazol-2-yl)-N-[4-(trifluoromethyl)phenyl]acetamide is O=C(Cc1nnc(-c2cnccn2)o1)Nc1ccc(C(F)(F)F)cc1.
What is the InChIKey of 2-(5-pyrazin-2-yl-1,3,4-oxadiazol-2-yl)-N-[4-(trifluoromethyl)phenyl]acetamide?
The InChIKey is YYBFZBRUJYRENJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10F3N5O2/c16-15(17,18)9-1-3-10(4-2-9)21-12(24)7-13-22-23-14(25-13)11-8-19-5-6-20-11/h1-6,8H,7H2,(H,21,24).
What are the key properties of 2-(5-pyrazin-2-yl-1,3,4-oxadiazol-2-yl)-N-[4-(trifluoromethyl)phenyl]acetamide?
2-(5-pyrazin-2-yl-1,3,4-oxadiazol-2-yl)-N-[4-(trifluoromethyl)phenyl]acetamide has a molecular weight of 349.27 g/mol, XLogP of 2.73, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-pyrazin-2-yl-1,3,4-oxadiazol-2-yl)-N-[4-(trifluoromethyl)phenyl]acetamide is sourced from PubChem (CID 53162214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).