About dodecyl 2-phenylsulfanylacetate
dodecyl 2-phenylsulfanylacetate (PubChem CID 531632) has the molecular formula C20H32O2S
and a molecular weight of 336.54 g/mol. Its IUPAC name is dodecyl 2-phenylsulfanylacetate.
Molecular Properties
| Compound Name | dodecyl 2-phenylsulfanylacetate |
| PubChem CID | 531632 |
| Molecular Formula | C20H32O2S |
| Molecular Weight | 336.54 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | dodecyl 2-phenylsulfanylacetate |
| SMILES | CCCCCCCCCCCCOC(=O)CSc1ccccc1 |
| InChI | InChI=1S/C20H32O2S/c1-2-3-4-5-6-7-8-9-10-14-17-22-20(21)18-23-19-15-12-11-13-16-19/h11-13,15-16H,2-10,14,17-18H2,1H3 |
| InChIKey | UZXYYFYUFDWZCI-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.54 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dodecyl 2-phenylsulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodecyl 2-phenylsulfanylacetate?
The IUPAC name of dodecyl 2-phenylsulfanylacetate (CID 531632) is dodecyl 2-phenylsulfanylacetate.
What is the SMILES notation for dodecyl 2-phenylsulfanylacetate?
The canonical SMILES for dodecyl 2-phenylsulfanylacetate is CCCCCCCCCCCCOC(=O)CSc1ccccc1.
What is the InChIKey of dodecyl 2-phenylsulfanylacetate?
The InChIKey is UZXYYFYUFDWZCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H32O2S/c1-2-3-4-5-6-7-8-9-10-14-17-22-20(21)18-23-19-15-12-11-13-16-19/h11-13,15-16H,2-10,14,17-18H2,1H3.
What are the key properties of dodecyl 2-phenylsulfanylacetate?
dodecyl 2-phenylsulfanylacetate has a molecular weight of 336.54 g/mol, XLogP of 6.24, 14 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dodecyl 2-phenylsulfanylacetate is sourced from PubChem (CID 531632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).