C15H14ClN3O3S — CID 53163402
N-(5-chloro-2-methylphenyl)-2-methyl-5-(1H-pyrazol-5-yl)furan-3-sulfonamide (PubChem CID 53163402) has the molecular formula C15H14ClN3O3S and a molecular weight of 351.82 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-2-methyl-5-(1H-pyrazol-5-yl)furan-3-sulfonamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-2-methyl-5-(1H-pyrazol-5-yl)furan-3-sulfonamide |
|---|---|
| PubChem CID | 53163402 |
| Molecular Formula | C15H14ClN3O3S |
| Molecular Weight | 351.82 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-2-methyl-5-(1H-pyrazol-5-yl)furan-3-sulfonamide |
| SMILES | Cc1ccc(Cl)cc1NS(=O)(=O)c1cc(-c2ccn[nH]2)oc1C |
| InChI | InChI=1S/C15H14ClN3O3S/c1-9-3-4-11(16)7-13(9)19-23(20,21)15-8-14(22-10(15)2)12-5-6-17-18-12/h3-8,19H,1-2H3,(H,17,18) |
| InChIKey | ZQVDUQNVICYSPP-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.82 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |