C20H23N3O — CID 53164087
3,5-dimethyl-N-[(1-propan-2-ylindazol-3-yl)methyl]benzamide (PubChem CID 53164087) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is 3,5-dimethyl-N-[(1-propan-2-ylindazol-3-yl)methyl]benzamide.
| Compound Name | 3,5-dimethyl-N-[(1-propan-2-ylindazol-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 53164087 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 3,5-dimethyl-N-[(1-propan-2-ylindazol-3-yl)methyl]benzamide |
| SMILES | Cc1cc(C)cc(C(=O)NCc2nn(C(C)C)c3ccccc23)c1 |
| InChI | InChI=1S/C20H23N3O/c1-13(2)23-19-8-6-5-7-17(19)18(22-23)12-21-20(24)16-10-14(3)9-15(4)11-16/h5-11,13H,12H2,1-4H3,(H,21,24) |
| InChIKey | HCZBRYKDYKYWBD-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |