About tetradecyl pyridine-3-carboxylate
tetradecyl pyridine-3-carboxylate (PubChem CID 531641) has the molecular formula C20H33NO2
and a molecular weight of 319.49 g/mol. Its IUPAC name is tetradecyl pyridine-3-carboxylate.
Molecular Properties
| Compound Name | tetradecyl pyridine-3-carboxylate |
| PubChem CID | 531641 |
| Molecular Formula | C20H33NO2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | tetradecyl pyridine-3-carboxylate |
| SMILES | CCCCCCCCCCCCCCOC(=O)c1cccnc1 |
| InChI | InChI=1S/C20H33NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-17-23-20(22)19-15-14-16-21-18-19/h14-16,18H,2-13,17H2,1H3 |
| InChIKey | TVGLGJWCZSCAEM-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tetradecyl pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetradecyl pyridine-3-carboxylate?
The IUPAC name of tetradecyl pyridine-3-carboxylate (CID 531641) is tetradecyl pyridine-3-carboxylate.
What is the SMILES notation for tetradecyl pyridine-3-carboxylate?
The canonical SMILES for tetradecyl pyridine-3-carboxylate is CCCCCCCCCCCCCCOC(=O)c1cccnc1.
What is the InChIKey of tetradecyl pyridine-3-carboxylate?
The InChIKey is TVGLGJWCZSCAEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H33NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-17-23-20(22)19-15-14-16-21-18-19/h14-16,18H,2-13,17H2,1H3.
What are the key properties of tetradecyl pyridine-3-carboxylate?
tetradecyl pyridine-3-carboxylate has a molecular weight of 319.49 g/mol, XLogP of 5.94, 14 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tetradecyl pyridine-3-carboxylate is sourced from PubChem (CID 531641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).