About N-[3-(1,4-dioxa-8-azaspiro[4.5]decane-8-carbonyl)pyrazin-2-yl]-4-methylbenzamide
N-[3-(1,4-dioxa-8-azaspiro[4.5]decane-8-carbonyl)pyrazin-2-yl]-4-methylbenzamide (PubChem CID 53166482) has the molecular formula C20H22N4O4
and a molecular weight of 382.42 g/mol. Its IUPAC name is N-[3-(1,4-dioxa-8-azaspiro[4.5]decane-8-carbonyl)pyrazin-2-yl]-4-methylbenzamide.
Molecular Properties
| Compound Name | N-[3-(1,4-dioxa-8-azaspiro[4.5]decane-8-carbonyl)pyrazin-2-yl]-4-methylbenzamide |
| PubChem CID | 53166482 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | N-[3-(1,4-dioxa-8-azaspiro[4.5]decane-8-carbonyl)pyrazin-2-yl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2nccnc2C(=O)N2CCC3(CC2)OCCO3)cc1 |
| InChI | InChI=1S/C20H22N4O4/c1-14-2-4-15(5-3-14)18(25)23-17-16(21-8-9-22-17)19(26)24-10-6-20(7-11-24)27-12-13-28-20/h2-5,8-9H,6-7,10-13H2,1H3,(H,22,23,25) |
| InChIKey | XSDTWKONVSRXBR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[3-(1,4-dioxa-8-azaspiro[4.5]decane-8-carbonyl)pyrazin-2-yl]-4-methylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(1,4-dioxa-8-azaspiro[4.5]decane-8-carbonyl)pyrazin-2-yl]-4-methylbenzamide?
The IUPAC name of N-[3-(1,4-dioxa-8-azaspiro[4.5]decane-8-carbonyl)pyrazin-2-yl]-4-methylbenzamide (CID 53166482) is N-[3-(1,4-dioxa-8-azaspiro[4.5]decane-8-carbonyl)pyrazin-2-yl]-4-methylbenzamide.
What is the SMILES notation for N-[3-(1,4-dioxa-8-azaspiro[4.5]decane-8-carbonyl)pyrazin-2-yl]-4-methylbenzamide?
The canonical SMILES for N-[3-(1,4-dioxa-8-azaspiro[4.5]decane-8-carbonyl)pyrazin-2-yl]-4-methylbenzamide is Cc1ccc(C(=O)Nc2nccnc2C(=O)N2CCC3(CC2)OCCO3)cc1.
What is the InChIKey of N-[3-(1,4-dioxa-8-azaspiro[4.5]decane-8-carbonyl)pyrazin-2-yl]-4-methylbenzamide?
The InChIKey is XSDTWKONVSRXBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N4O4/c1-14-2-4-15(5-3-14)18(25)23-17-16(21-8-9-22-17)19(26)24-10-6-20(7-11-24)27-12-13-28-20/h2-5,8-9H,6-7,10-13H2,1H3,(H,22,23,25).
What are the key properties of N-[3-(1,4-dioxa-8-azaspiro[4.5]decane-8-carbonyl)pyrazin-2-yl]-4-methylbenzamide?
N-[3-(1,4-dioxa-8-azaspiro[4.5]decane-8-carbonyl)pyrazin-2-yl]-4-methylbenzamide has a molecular weight of 382.42 g/mol, XLogP of 2.02, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(1,4-dioxa-8-azaspiro[4.5]decane-8-carbonyl)pyrazin-2-yl]-4-methylbenzamide is sourced from PubChem (CID 53166482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).