C19H24O3 — CID 5316656
(4bS)-1-hydroxy-4b,8,8-trimethyl-2-propan-2-yl-6,7-dihydro-5H-fluorene-3,4-dione (PubChem CID 5316656) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is (4bS)-1-hydroxy-4b,8,8-trimethyl-2-propan-2-yl-6,7-dihydro-5H-fluorene-3,4-dione.
| Compound Name | (4bS)-1-hydroxy-4b,8,8-trimethyl-2-propan-2-yl-6,7-dihydro-5H-fluorene-3,4-dione |
|---|---|
| PubChem CID | 5316656 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | (4bS)-1-hydroxy-4b,8,8-trimethyl-2-propan-2-yl-6,7-dihydro-5H-fluorene-3,4-dione |
| SMILES | CC(C)C1=C(O)C2=C(C(=O)C1=O)[C@@]1(C)CCCC(C)(C)C1=C2 |
| InChI | InChI=1S/C19H24O3/c1-10(2)13-15(20)11-9-12-18(3,4)7-6-8-19(12,5)14(11)17(22)16(13)21/h9-10,20H,6-8H2,1-5H3/t19-/m0/s1 |
| InChIKey | WMWMKDIHCOZLTG-IBGZPJMESA-N |
| XLogP | 4.06 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|