About 5-ethyl-2-methyl-3-(4-phenylpiperazine-1-carbonyl)furo[3,2-c]pyridin-4-one
5-ethyl-2-methyl-3-(4-phenylpiperazine-1-carbonyl)furo[3,2-c]pyridin-4-one (PubChem CID 53167342) has the molecular formula C21H23N3O3
and a molecular weight of 365.43 g/mol. Its IUPAC name is 5-ethyl-2-methyl-3-(4-phenylpiperazine-1-carbonyl)furo[3,2-c]pyridin-4-one.
Molecular Properties
| Compound Name | 5-ethyl-2-methyl-3-(4-phenylpiperazine-1-carbonyl)furo[3,2-c]pyridin-4-one |
| PubChem CID | 53167342 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 5-ethyl-2-methyl-3-(4-phenylpiperazine-1-carbonyl)furo[3,2-c]pyridin-4-one |
| SMILES | CCn1ccc2oc(C)c(C(=O)N3CCN(c4ccccc4)CC3)c2c1=O |
| InChI | InChI=1S/C21H23N3O3/c1-3-22-10-9-17-19(21(22)26)18(15(2)27-17)20(25)24-13-11-23(12-14-24)16-7-5-4-6-8-16/h4-10H,3,11-14H2,1-2H3 |
| InChIKey | GKTIAORLFBAPCA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 58.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-ethyl-2-methyl-3-(4-phenylpiperazine-1-carbonyl)furo[3,2-c]pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-2-methyl-3-(4-phenylpiperazine-1-carbonyl)furo[3,2-c]pyridin-4-one?
The IUPAC name of 5-ethyl-2-methyl-3-(4-phenylpiperazine-1-carbonyl)furo[3,2-c]pyridin-4-one (CID 53167342) is 5-ethyl-2-methyl-3-(4-phenylpiperazine-1-carbonyl)furo[3,2-c]pyridin-4-one.
What is the SMILES notation for 5-ethyl-2-methyl-3-(4-phenylpiperazine-1-carbonyl)furo[3,2-c]pyridin-4-one?
The canonical SMILES for 5-ethyl-2-methyl-3-(4-phenylpiperazine-1-carbonyl)furo[3,2-c]pyridin-4-one is CCn1ccc2oc(C)c(C(=O)N3CCN(c4ccccc4)CC3)c2c1=O.
What is the InChIKey of 5-ethyl-2-methyl-3-(4-phenylpiperazine-1-carbonyl)furo[3,2-c]pyridin-4-one?
The InChIKey is GKTIAORLFBAPCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N3O3/c1-3-22-10-9-17-19(21(22)26)18(15(2)27-17)20(25)24-13-11-23(12-14-24)16-7-5-4-6-8-16/h4-10H,3,11-14H2,1-2H3.
What are the key properties of 5-ethyl-2-methyl-3-(4-phenylpiperazine-1-carbonyl)furo[3,2-c]pyridin-4-one?
5-ethyl-2-methyl-3-(4-phenylpiperazine-1-carbonyl)furo[3,2-c]pyridin-4-one has a molecular weight of 365.43 g/mol, XLogP of 2.89, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-2-methyl-3-(4-phenylpiperazine-1-carbonyl)furo[3,2-c]pyridin-4-one is sourced from PubChem (CID 53167342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).