C15H21N5O2S — CID 53167424
4-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(3-piperidin-1-ylpropyl)-1,3-thiazole-2-carboxamide (PubChem CID 53167424) has the molecular formula C15H21N5O2S and a molecular weight of 335.43 g/mol. Its IUPAC name is 4-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(3-piperidin-1-ylpropyl)-1,3-thiazole-2-carboxamide.
| Compound Name | 4-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(3-piperidin-1-ylpropyl)-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 53167424 |
| Molecular Formula | C15H21N5O2S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 4-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(3-piperidin-1-ylpropyl)-1,3-thiazole-2-carboxamide |
| SMILES | Cc1noc(-c2csc(C(=O)NCCCN3CCCCC3)n2)n1 |
| InChI | InChI=1S/C15H21N5O2S/c1-11-17-14(22-19-11)12-10-23-15(18-12)13(21)16-6-5-9-20-7-3-2-4-8-20/h10H,2-9H2,1H3,(H,16,21) |
| InChIKey | AKBFYBZAWKMJNH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 84.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|