C15H24N4OS — CID 53167871
N-(3-piperidin-1-ylpropyl)-6,8-dihydro-5H-imidazo[2,1-c][1,4]thiazine-2-carboxamide (PubChem CID 53167871) has the molecular formula C15H24N4OS and a molecular weight of 308.45 g/mol. Its IUPAC name is N-(3-piperidin-1-ylpropyl)-6,8-dihydro-5H-imidazo[2,1-c][1,4]thiazine-2-carboxamide.
| Compound Name | N-(3-piperidin-1-ylpropyl)-6,8-dihydro-5H-imidazo[2,1-c][1,4]thiazine-2-carboxamide |
|---|---|
| PubChem CID | 53167871 |
| Molecular Formula | C15H24N4OS |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | N-(3-piperidin-1-ylpropyl)-6,8-dihydro-5H-imidazo[2,1-c][1,4]thiazine-2-carboxamide |
| SMILES | O=C(NCCCN1CCCCC1)c1cn2c(n1)CSCC2 |
| InChI | InChI=1S/C15H24N4OS/c20-15(13-11-19-9-10-21-12-14(19)17-13)16-5-4-8-18-6-2-1-3-7-18/h11H,1-10,12H2,(H,16,20) |
| InChIKey | JKALSKDGDUKOQD-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|