C11H16O5 — CID 5316806
(1R,4R,4aS,7aS)-4,7-bis(hydroxymethyl)-1-methoxy-4,4a,5,7a-tetrahydro-1H-cyclopenta[c]pyran-3-one (PubChem CID 5316806) has the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. Its IUPAC name is (1R,4R,4aS,7aS)-4,7-bis(hydroxymethyl)-1-methoxy-4,4a,5,7a-tetrahydro-1H-cyclopenta[c]pyran-3-one.
| Compound Name | (1R,4R,4aS,7aS)-4,7-bis(hydroxymethyl)-1-methoxy-4,4a,5,7a-tetrahydro-1H-cyclopenta[c]pyran-3-one |
|---|---|
| PubChem CID | 5316806 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | (1R,4R,4aS,7aS)-4,7-bis(hydroxymethyl)-1-methoxy-4,4a,5,7a-tetrahydro-1H-cyclopenta[c]pyran-3-one |
| SMILES | CO[C@@H]1OC(=O)[C@@H](CO)[C@H]2CC=C(CO)[C@@H]12 |
| InChI | InChI=1S/C11H16O5/c1-15-11-9-6(4-12)2-3-7(9)8(5-13)10(14)16-11/h2,7-9,11-13H,3-5H2,1H3/t7-,8+,9-,11-/m1/s1 |
| InChIKey | DIZSYMXWQCKVJY-PKIKSRDPSA-N |
| XLogP | -0.32 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|