C30H48O3 — CID 5316813
6,10-dihydroxy-2,2,4a,6a,6b,9,9,12a-octamethyl-3,4,6,6a,7,8,8a,10,11,12,13,14b-dodecahydro-1H-picen-5-one (PubChem CID 5316813) has the molecular formula C30H48O3 and a molecular weight of 456.71 g/mol. Its IUPAC name is 6,10-dihydroxy-2,2,4a,6a,6b,9,9,12a-octamethyl-3,4,6,6a,7,8,8a,10,11,12,13,14b-dodecahydro-1H-picen-5-one.
| Compound Name | 6,10-dihydroxy-2,2,4a,6a,6b,9,9,12a-octamethyl-3,4,6,6a,7,8,8a,10,11,12,13,14b-dodecahydro-1H-picen-5-one |
|---|---|
| PubChem CID | 5316813 |
| Molecular Formula | C30H48O3 |
| Molecular Weight | 456.71 g/mol |
| Exact Mass | 456.36 |
| IUPAC Name | 6,10-dihydroxy-2,2,4a,6a,6b,9,9,12a-octamethyl-3,4,6,6a,7,8,8a,10,11,12,13,14b-dodecahydro-1H-picen-5-one |
| SMILES | CC1(C)CCC2(C)C(=O)C(O)C3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1 |
| InChI | InChI=1S/C30H48O3/c1-25(2)15-16-27(5)19(17-25)18-9-10-21-28(6)13-12-22(31)26(3,4)20(28)11-14-29(21,7)30(18,8)24(33)23(27)32/h9,19-22,24,31,33H,10-17H2,1-8H3 |
| InChIKey | FTCCZVMCIHJNMD-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.71 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|