C20H30N6O — CID 53168150
4-(dimethylamino)-5,7-dimethyl-N-(3-piperidin-1-ylpropyl)pyrido[2,3-d]pyrimidine-2-carboxamide (PubChem CID 53168150) has the molecular formula C20H30N6O and a molecular weight of 370.50 g/mol. Its IUPAC name is 4-(dimethylamino)-5,7-dimethyl-N-(3-piperidin-1-ylpropyl)pyrido[2,3-d]pyrimidine-2-carboxamide.
| Compound Name | 4-(dimethylamino)-5,7-dimethyl-N-(3-piperidin-1-ylpropyl)pyrido[2,3-d]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 53168150 |
| Molecular Formula | C20H30N6O |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | 4-(dimethylamino)-5,7-dimethyl-N-(3-piperidin-1-ylpropyl)pyrido[2,3-d]pyrimidine-2-carboxamide |
| SMILES | Cc1cc(C)c2c(N(C)C)nc(C(=O)NCCCN3CCCCC3)nc2n1 |
| InChI | InChI=1S/C20H30N6O/c1-14-13-15(2)22-17-16(14)19(25(3)4)24-18(23-17)20(27)21-9-8-12-26-10-6-5-7-11-26/h13H,5-12H2,1-4H3,(H,21,27) |
| InChIKey | HTHSNFHEUFMTDK-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|