About 2,3-dihydroxy-1,3-diphenylpropan-1-one
2,3-dihydroxy-1,3-diphenylpropan-1-one (PubChem CID 5316933) has the molecular formula C15H14O3
and a molecular weight of 242.27 g/mol. Its IUPAC name is 2,3-dihydroxy-1,3-diphenylpropan-1-one.
Molecular Properties
| Compound Name | 2,3-dihydroxy-1,3-diphenylpropan-1-one |
| PubChem CID | 5316933 |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 2,3-dihydroxy-1,3-diphenylpropan-1-one |
| SMILES | O=C(c1ccccc1)C(O)C(O)c1ccccc1 |
| InChI | InChI=1S/C15H14O3/c16-13(11-7-3-1-4-8-11)15(18)14(17)12-9-5-2-6-10-12/h1-10,13,15-16,18H |
| InChIKey | QOFVVEZPQRISRL-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dihydroxy-1,3-diphenylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroxy-1,3-diphenylpropan-1-one?
The IUPAC name of 2,3-dihydroxy-1,3-diphenylpropan-1-one (CID 5316933) is 2,3-dihydroxy-1,3-diphenylpropan-1-one.
What is the SMILES notation for 2,3-dihydroxy-1,3-diphenylpropan-1-one?
The canonical SMILES for 2,3-dihydroxy-1,3-diphenylpropan-1-one is O=C(c1ccccc1)C(O)C(O)c1ccccc1.
What is the InChIKey of 2,3-dihydroxy-1,3-diphenylpropan-1-one?
The InChIKey is QOFVVEZPQRISRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O3/c16-13(11-7-3-1-4-8-11)15(18)14(17)12-9-5-2-6-10-12/h1-10,13,15-16,18H.
What are the key properties of 2,3-dihydroxy-1,3-diphenylpropan-1-one?
2,3-dihydroxy-1,3-diphenylpropan-1-one has a molecular weight of 242.27 g/mol, XLogP of 1.96, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxy-1,3-diphenylpropan-1-one is sourced from PubChem (CID 5316933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).