About N-(2-chlorophenyl)-1-methyl-4-oxospiro[3H-quinazoline-2,4'-piperidine]-1'-carboxamide
N-(2-chlorophenyl)-1-methyl-4-oxospiro[3H-quinazoline-2,4'-piperidine]-1'-carboxamide (PubChem CID 53169537) has the molecular formula C20H21ClN4O2
and a molecular weight of 384.87 g/mol. Its IUPAC name is N-(2-chlorophenyl)-1-methyl-4-oxospiro[3H-quinazoline-2,4'-piperidine]-1'-carboxamide.
Molecular Properties
| Compound Name | N-(2-chlorophenyl)-1-methyl-4-oxospiro[3H-quinazoline-2,4'-piperidine]-1'-carboxamide |
| PubChem CID | 53169537 |
| Molecular Formula | C20H21ClN4O2 |
| Molecular Weight | 384.87 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | N-(2-chlorophenyl)-1-methyl-4-oxospiro[3H-quinazoline-2,4'-piperidine]-1'-carboxamide |
| SMILES | CN1c2ccccc2C(=O)NC12CCN(C(=O)Nc1ccccc1Cl)CC2 |
| InChI | InChI=1S/C20H21ClN4O2/c1-24-17-9-5-2-6-14(17)18(26)23-20(24)10-12-25(13-11-20)19(27)22-16-8-4-3-7-15(16)21/h2-9H,10-13H2,1H3,(H,22,27)(H,23,26) |
| InChIKey | GUFANIBLPGUBRG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.87 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-chlorophenyl)-1-methyl-4-oxospiro[3H-quinazoline-2,4'-piperidine]-1'-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chlorophenyl)-1-methyl-4-oxospiro[3H-quinazoline-2,4'-piperidine]-1'-carboxamide?
The IUPAC name of N-(2-chlorophenyl)-1-methyl-4-oxospiro[3H-quinazoline-2,4'-piperidine]-1'-carboxamide (CID 53169537) is N-(2-chlorophenyl)-1-methyl-4-oxospiro[3H-quinazoline-2,4'-piperidine]-1'-carboxamide.
What is the SMILES notation for N-(2-chlorophenyl)-1-methyl-4-oxospiro[3H-quinazoline-2,4'-piperidine]-1'-carboxamide?
The canonical SMILES for N-(2-chlorophenyl)-1-methyl-4-oxospiro[3H-quinazoline-2,4'-piperidine]-1'-carboxamide is CN1c2ccccc2C(=O)NC12CCN(C(=O)Nc1ccccc1Cl)CC2.
What is the InChIKey of N-(2-chlorophenyl)-1-methyl-4-oxospiro[3H-quinazoline-2,4'-piperidine]-1'-carboxamide?
The InChIKey is GUFANIBLPGUBRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21ClN4O2/c1-24-17-9-5-2-6-14(17)18(26)23-20(24)10-12-25(13-11-20)19(27)22-16-8-4-3-7-15(16)21/h2-9H,10-13H2,1H3,(H,22,27)(H,23,26).
What are the key properties of N-(2-chlorophenyl)-1-methyl-4-oxospiro[3H-quinazoline-2,4'-piperidine]-1'-carboxamide?
N-(2-chlorophenyl)-1-methyl-4-oxospiro[3H-quinazoline-2,4'-piperidine]-1'-carboxamide has a molecular weight of 384.87 g/mol, XLogP of 3.54, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chlorophenyl)-1-methyl-4-oxospiro[3H-quinazoline-2,4'-piperidine]-1'-carboxamide is sourced from PubChem (CID 53169537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).