C13H18N2O5S — CID 53170566
methyl 2-(2-oxo-5-piperidin-1-ylsulfonyl-1-pyridinyl)acetate (PubChem CID 53170566) has the molecular formula C13H18N2O5S and a molecular weight of 314.36 g/mol. Its IUPAC name is methyl 2-(2-oxo-5-piperidin-1-ylsulfonyl-1-pyridinyl)acetate.
| Compound Name | methyl 2-(2-oxo-5-piperidin-1-ylsulfonyl-1-pyridinyl)acetate |
|---|---|
| PubChem CID | 53170566 |
| Molecular Formula | C13H18N2O5S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | methyl 2-(2-oxo-5-piperidin-1-ylsulfonyl-1-pyridinyl)acetate |
| SMILES | COC(=O)Cn1cc(S(=O)(=O)N2CCCCC2)ccc1=O |
| InChI | InChI=1S/C13H18N2O5S/c1-20-13(17)10-14-9-11(5-6-12(14)16)21(18,19)15-7-3-2-4-8-15/h5-6,9H,2-4,7-8,10H2,1H3 |
| InChIKey | XTQTXAKHCBHSKC-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |