C16H15ClN6O — CID 53172146
N-(3-chlorophenyl)-1-[6-(dimethylamino)pyrimidin-4-yl]imidazole-4-carboxamide (PubChem CID 53172146) has the molecular formula C16H15ClN6O and a molecular weight of 342.79 g/mol. Its IUPAC name is N-(3-chlorophenyl)-1-[6-(dimethylamino)pyrimidin-4-yl]imidazole-4-carboxamide.
| Compound Name | N-(3-chlorophenyl)-1-[6-(dimethylamino)pyrimidin-4-yl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 53172146 |
| Molecular Formula | C16H15ClN6O |
| Molecular Weight | 342.79 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | N-(3-chlorophenyl)-1-[6-(dimethylamino)pyrimidin-4-yl]imidazole-4-carboxamide |
| SMILES | CN(C)c1cc(-n2cnc(C(=O)Nc3cccc(Cl)c3)c2)ncn1 |
| InChI | InChI=1S/C16H15ClN6O/c1-22(2)14-7-15(19-9-18-14)23-8-13(20-10-23)16(24)21-12-5-3-4-11(17)6-12/h3-10H,1-2H3,(H,21,24) |
| InChIKey | XKMIJMUNIZBVFJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.79 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |