C11H14N4O — CID 53172232
4-(3-methylimidazo[1,5-a]pyrazin-8-yl)morpholine (PubChem CID 53172232) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is 4-(3-methylimidazo[1,5-a]pyrazin-8-yl)morpholine.
| Compound Name | 4-(3-methylimidazo[1,5-a]pyrazin-8-yl)morpholine |
|---|---|
| PubChem CID | 53172232 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 4-(3-methylimidazo[1,5-a]pyrazin-8-yl)morpholine |
| SMILES | Cc1ncc2c(N3CCOCC3)nccn12 |
| InChI | InChI=1S/C11H14N4O/c1-9-13-8-10-11(12-2-3-15(9)10)14-4-6-16-7-5-14/h2-3,8H,4-7H2,1H3 |
| InChIKey | NMSVZLZACMMIRV-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 42.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |